About 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine
4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103329896) has the molecular formula C16H24N4S
and a molecular weight of 304.46 g/mol. Its IUPAC name is 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine |
| PubChem CID | 103329896 |
| Molecular Formula | C16H24N4S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCC1CCCCCN1c1nc(NC)nc2sc(C)cc12 |
| InChI | InChI=1S/C16H24N4S/c1-4-12-8-6-5-7-9-20(12)14-13-10-11(2)21-15(13)19-16(17-3)18-14/h10,12H,4-9H2,1-3H3,(H,17,18,19) |
| InChIKey | BHKLNIRSFLJJQB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine?
The IUPAC name of 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine (CID 103329896) is 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine.
What is the SMILES notation for 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine?
The canonical SMILES for 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine is CCC1CCCCCN1c1nc(NC)nc2sc(C)cc12.
What is the InChIKey of 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine?
The InChIKey is BHKLNIRSFLJJQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4S/c1-4-12-8-6-5-7-9-20(12)14-13-10-11(2)21-15(13)19-16(17-3)18-14/h10,12H,4-9H2,1-3H3,(H,17,18,19).
What are the key properties of 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine?
4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine has a molecular weight of 304.46 g/mol, XLogP of 4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethylazepan-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine is sourced from PubChem (CID 103329896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).