C14H12ClN3OS — CID 103331812
4-(4-chlorophenoxy)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103331812) has the molecular formula C14H12ClN3OS and a molecular weight of 305.79 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(4-chlorophenoxy)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103331812 |
| Molecular Formula | C14H12ClN3OS |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 4-(4-chlorophenoxy)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1nc(Oc2ccc(Cl)cc2)c2cc(C)sc2n1 |
| InChI | InChI=1S/C14H12ClN3OS/c1-8-7-11-12(17-14(16-2)18-13(11)20-8)19-10-5-3-9(15)4-6-10/h3-7H,1-2H3,(H,16,17,18) |
| InChIKey | PXTHXCLJLRDXFU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |