C9H11N3OS — CID 103331394
4-methoxy-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103331394) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 4-methoxy-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-methoxy-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103331394 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 4-methoxy-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1nc(OC)c2cc(C)sc2n1 |
| InChI | InChI=1S/C9H11N3OS/c1-5-4-6-7(13-3)11-9(10-2)12-8(6)14-5/h4H,1-3H3,(H,10,11,12) |
| InChIKey | HHXNXGLQGIFEAC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |