C13H17N3O2S — CID 103332150
N,6-dimethyl-4-(oxan-4-yloxy)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 103332150) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is N,6-dimethyl-4-(oxan-4-yloxy)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | N,6-dimethyl-4-(oxan-4-yloxy)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103332150 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N,6-dimethyl-4-(oxan-4-yloxy)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1nc(OC2CCOCC2)c2cc(C)sc2n1 |
| InChI | InChI=1S/C13H17N3O2S/c1-8-7-10-11(18-9-3-5-17-6-4-9)15-13(14-2)16-12(10)19-8/h7,9H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | MHMFPXXHZWISPB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |