C13H17N3OS — CID 103332934
N,6-dimethyl-4-pent-4-enoxythieno[2,3-d]pyrimidin-2-amine (PubChem CID 103332934) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is N,6-dimethyl-4-pent-4-enoxythieno[2,3-d]pyrimidin-2-amine.
| Compound Name | N,6-dimethyl-4-pent-4-enoxythieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103332934 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N,6-dimethyl-4-pent-4-enoxythieno[2,3-d]pyrimidin-2-amine |
| SMILES | C=CCCCOc1nc(NC)nc2sc(C)cc12 |
| InChI | InChI=1S/C13H17N3OS/c1-4-5-6-7-17-11-10-8-9(2)18-12(10)16-13(14-3)15-11/h4,8H,1,5-7H2,2-3H3,(H,14,15,16) |
| InChIKey | UKMMATDCYVIHDZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|