C14H22N6S — CID 103332422
N-[(1-ethylpyrrolidin-3-yl)methyl]-2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 103332422) has the molecular formula C14H22N6S and a molecular weight of 306.44 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-3-yl)methyl]-2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(1-ethylpyrrolidin-3-yl)methyl]-2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103332422 |
| Molecular Formula | C14H22N6S |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-[(1-ethylpyrrolidin-3-yl)methyl]-2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCN1CCC(CNc2nc(NN)nc3sc(C)cc23)C1 |
| InChI | InChI=1S/C14H22N6S/c1-3-20-5-4-10(8-20)7-16-12-11-6-9(2)21-13(11)18-14(17-12)19-15/h6,10H,3-5,7-8,15H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | AZBNAPCXBAXPCM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|