About methyl 4-oxo-3,4-diphenylbutanoate
methyl 4-oxo-3,4-diphenylbutanoate (PubChem CID 10333248) has the molecular formula C17H16O3
and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 4-oxo-3,4-diphenylbutanoate.
Molecular Properties
| Compound Name | methyl 4-oxo-3,4-diphenylbutanoate |
| PubChem CID | 10333248 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | methyl 4-oxo-3,4-diphenylbutanoate |
| SMILES | COC(=O)CC(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16O3/c1-20-16(18)12-15(13-8-4-2-5-9-13)17(19)14-10-6-3-7-11-14/h2-11,15H,12H2,1H3 |
| InChIKey | UEQVHTCQXGCFAC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-oxo-3,4-diphenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-oxo-3,4-diphenylbutanoate?
The IUPAC name of methyl 4-oxo-3,4-diphenylbutanoate (CID 10333248) is methyl 4-oxo-3,4-diphenylbutanoate.
What is the SMILES notation for methyl 4-oxo-3,4-diphenylbutanoate?
The canonical SMILES for methyl 4-oxo-3,4-diphenylbutanoate is COC(=O)CC(C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 4-oxo-3,4-diphenylbutanoate?
The InChIKey is UEQVHTCQXGCFAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3/c1-20-16(18)12-15(13-8-4-2-5-9-13)17(19)14-10-6-3-7-11-14/h2-11,15H,12H2,1H3.
What are the key properties of methyl 4-oxo-3,4-diphenylbutanoate?
methyl 4-oxo-3,4-diphenylbutanoate has a molecular weight of 268.31 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-3,4-diphenylbutanoate is sourced from PubChem (CID 10333248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).