C13H19N5OS — CID 103333025
2-[cyclopentyl-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]ethanol (PubChem CID 103333025) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is 2-[cyclopentyl-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]ethanol.
| Compound Name | 2-[cyclopentyl-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 103333025 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-[cyclopentyl-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]ethanol |
| SMILES | NNc1nc(N(CCO)C2CCCC2)c2ccsc2n1 |
| InChI | InChI=1S/C13H19N5OS/c14-17-13-15-11(10-5-8-20-12(10)16-13)18(6-7-19)9-3-1-2-4-9/h5,8-9,19H,1-4,6-7,14H2,(H,15,16,17) |
| InChIKey | ORDMCFZOIDVFIZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|