C13H11FN2O2 — CID 103336844
N-[(2-fluorophenyl)methyl]-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 103336844) has the molecular formula C13H11FN2O2 and a molecular weight of 246.24 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103336844 |
| Molecular Formula | C13H11FN2O2 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1F)c1c[nH]ccc1=O |
| InChI | InChI=1S/C13H11FN2O2/c14-11-4-2-1-3-9(11)7-16-13(18)10-8-15-6-5-12(10)17/h1-6,8H,7H2,(H,15,17)(H,16,18) |
| InChIKey | VUBLVCBIVXSAKV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |