C14H18N2O4 — CID 10333771
1-[(6-methoxy-1,4-benzodioxin-3-yl)methyl]-3-propylurea (PubChem CID 10333771) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 1-[(6-methoxy-1,4-benzodioxin-3-yl)methyl]-3-propylurea.
| Compound Name | 1-[(6-methoxy-1,4-benzodioxin-3-yl)methyl]-3-propylurea |
|---|---|
| PubChem CID | 10333771 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-[(6-methoxy-1,4-benzodioxin-3-yl)methyl]-3-propylurea |
| SMILES | CCCNC(=O)NCC1=COc2ccc(OC)cc2O1 |
| InChI | InChI=1S/C14H18N2O4/c1-3-6-15-14(17)16-8-11-9-19-12-5-4-10(18-2)7-13(12)20-11/h4-5,7,9H,3,6,8H2,1-2H3,(H2,15,16,17) |
| InChIKey | IYVPABIWLQSGSS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |