C13H15NO3 — CID 103338073
methyl (2S)-2-(4-cyano-2,6-dimethylphenoxy)propanoate (PubChem CID 103338073) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl (2S)-2-(4-cyano-2,6-dimethylphenoxy)propanoate.
| Compound Name | methyl (2S)-2-(4-cyano-2,6-dimethylphenoxy)propanoate |
|---|---|
| PubChem CID | 103338073 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | methyl (2S)-2-(4-cyano-2,6-dimethylphenoxy)propanoate |
| SMILES | COC(=O)[C@H](C)Oc1c(C)cc(C#N)cc1C |
| InChI | InChI=1S/C13H15NO3/c1-8-5-11(7-14)6-9(2)12(8)17-10(3)13(15)16-4/h5-6,10H,1-4H3/t10-/m0/s1 |
| InChIKey | URIIPLWASLCCGU-JTQLQIEISA-N |
| XLogP | 2.12 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |