About methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate
methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate (PubChem CID 65472479) has the molecular formula C13H17NO3S
and a molecular weight of 267.35 g/mol. Its IUPAC name is methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate.
Molecular Properties
| Compound Name | methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate |
| PubChem CID | 65472479 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate |
| SMILES | COC(=O)C(C)Oc1c(C)cc(C(N)=S)cc1C |
| InChI | InChI=1S/C13H17NO3S/c1-7-5-10(12(14)18)6-8(2)11(7)17-9(3)13(15)16-4/h5-6,9H,1-4H3,(H2,14,18) |
| InChIKey | DXOBFROVEDUFPT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate?
The IUPAC name of methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate (CID 65472479) is methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate.
What is the SMILES notation for methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate?
The canonical SMILES for methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate is COC(=O)C(C)Oc1c(C)cc(C(N)=S)cc1C.
What is the InChIKey of methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate?
The InChIKey is DXOBFROVEDUFPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3S/c1-7-5-10(12(14)18)6-8(2)11(7)17-9(3)13(15)16-4/h5-6,9H,1-4H3,(H2,14,18).
What are the key properties of methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate?
methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate has a molecular weight of 267.35 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-carbamothioyl-2,6-dimethylphenoxy)propanoate is sourced from PubChem (CID 65472479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).