C9H14F3NO3 — CID 103340505
2,2,2-trifluoroethyl N-(2-methoxyethyl)-N-prop-2-enylcarbamate (PubChem CID 103340505) has the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(2-methoxyethyl)-N-prop-2-enylcarbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(2-methoxyethyl)-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 103340505 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(2-methoxyethyl)-N-prop-2-enylcarbamate |
| SMILES | C=CCN(CCOC)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C9H14F3NO3/c1-3-4-13(5-6-15-2)8(14)16-7-9(10,11)12/h3H,1,4-7H2,2H3 |
| InChIKey | DZJDHRROAJVAFI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|