C11H16N2O4S2 — CID 103340937
2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]-2-methylpropanoic acid (PubChem CID 103340937) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]-2-methylpropanoic acid.
| Compound Name | 2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 103340937 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]-2-methylpropanoic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(SC(C)(C)C(=O)O)nc1 |
| InChI | InChI=1S/C11H16N2O4S2/c1-11(2,10(14)15)18-9-6-5-8(7-12-9)19(16,17)13(3)4/h5-7H,1-4H3,(H,14,15) |
| InChIKey | HVOKVOVTFPJMNX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |