C9H13ClN2O4S3 — CID 103341263
2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]ethanesulfonyl chloride (PubChem CID 103341263) has the molecular formula C9H13ClN2O4S3 and a molecular weight of 344.87 g/mol. Its IUPAC name is 2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]ethanesulfonyl chloride.
| Compound Name | 2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]ethanesulfonyl chloride |
|---|---|
| PubChem CID | 103341263 |
| Molecular Formula | C9H13ClN2O4S3 |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]ethanesulfonyl chloride |
| SMILES | CN(C)S(=O)(=O)c1ccc(SCCS(=O)(=O)Cl)nc1 |
| InChI | InChI=1S/C9H13ClN2O4S3/c1-12(2)19(15,16)8-3-4-9(11-7-8)17-5-6-18(10,13)14/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | QUERFQLEIVIPBW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |