C15H15BrClN3O3S2 — CID 24571729
N-(4-bromo-2-chlorophenyl)-2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]acetamide (PubChem CID 24571729) has the molecular formula C15H15BrClN3O3S2 and a molecular weight of 464.79 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 24571729 |
| Molecular Formula | C15H15BrClN3O3S2 |
| Molecular Weight | 464.79 g/mol |
| Exact Mass | 462.94 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(SCC(=O)Nc2ccc(Br)cc2Cl)nc1 |
| InChI | InChI=1S/C15H15BrClN3O3S2/c1-20(2)25(22,23)11-4-6-15(18-8-11)24-9-14(21)19-13-5-3-10(16)7-12(13)17/h3-8H,9H2,1-2H3,(H,19,21) |
| InChIKey | OWVTYCFQPSKLMK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |