C13H21NO5S — CID 103343032
2-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)sulfonyl]cyclopentane-1-carboxylic acid (PubChem CID 103343032) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)sulfonyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)sulfonyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103343032 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)sulfonyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1S(=O)(=O)N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C13H21NO5S/c15-10-6-8-4-5-9(7-10)14(8)20(18,19)12-3-1-2-11(12)13(16)17/h8-12,15H,1-7H2,(H,16,17) |
| InChIKey | ZVPMBQUNZBWOBE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |