C12H24N2O4S — CID 103343240
methyl 2-[methyl-[3-(methylamino)propyl]sulfamoyl]cyclopentane-1-carboxylate (PubChem CID 103343240) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is methyl 2-[methyl-[3-(methylamino)propyl]sulfamoyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 2-[methyl-[3-(methylamino)propyl]sulfamoyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103343240 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | methyl 2-[methyl-[3-(methylamino)propyl]sulfamoyl]cyclopentane-1-carboxylate |
| SMILES | CNCCCN(C)S(=O)(=O)C1CCCC1C(=O)OC |
| InChI | InChI=1S/C12H24N2O4S/c1-13-8-5-9-14(2)19(16,17)11-7-4-6-10(11)12(15)18-3/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | MUCWXFYMONHWFG-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|