About trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate
trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate (PubChem CID 98115809) has the molecular formula C7H11ClO4S
and a molecular weight of 226.68 g/mol. Its IUPAC name is trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate.
Analyze trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate?
The IUPAC name of trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate (CID 98115809) is trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate.
What is the SMILES notation for trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate?
The canonical SMILES for trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate is COC(=O)[C@H]1CCC[C@@H]1S(=O)(=O)Cl.
What is the InChIKey of trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate?
The InChIKey is AXFYZSWSTCZCQT-WDSKDSINSA-N. The full InChI is InChI=1S/C7H11ClO4S/c1-12-7(9)5-3-2-4-6(5)13(8,10)11/h5-6H,2-4H2,1H3/t5-,6-/m0/s1.
What are the key properties of trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate?
trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate has a molecular weight of 226.68 g/mol, XLogP of 0.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1R,2S)-2-chlorosulfonylcyclopentane-1-carboxylate is sourced from PubChem (CID 98115809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).