C10H19NO5S — CID 103342399
methyl 2-(1-hydroxypropan-2-ylsulfamoyl)cyclopentane-1-carboxylate (PubChem CID 103342399) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is methyl 2-(1-hydroxypropan-2-ylsulfamoyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 2-(1-hydroxypropan-2-ylsulfamoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103342399 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | methyl 2-(1-hydroxypropan-2-ylsulfamoyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCCC1S(=O)(=O)NC(C)CO |
| InChI | InChI=1S/C10H19NO5S/c1-7(6-12)11-17(14,15)9-5-3-4-8(9)10(13)16-2/h7-9,11-12H,3-6H2,1-2H3 |
| InChIKey | ZMSFAXMJQKOLOE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |