C13H25NO4S2 — CID 103343483
methyl 2-(4-ethylsulfanylbutan-2-ylsulfamoyl)cyclopentane-1-carboxylate (PubChem CID 103343483) has the molecular formula C13H25NO4S2 and a molecular weight of 323.48 g/mol. Its IUPAC name is methyl 2-(4-ethylsulfanylbutan-2-ylsulfamoyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 2-(4-ethylsulfanylbutan-2-ylsulfamoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103343483 |
| Molecular Formula | C13H25NO4S2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | methyl 2-(4-ethylsulfanylbutan-2-ylsulfamoyl)cyclopentane-1-carboxylate |
| SMILES | CCSCCC(C)NS(=O)(=O)C1CCCC1C(=O)OC |
| InChI | InChI=1S/C13H25NO4S2/c1-4-19-9-8-10(2)14-20(16,17)12-7-5-6-11(12)13(15)18-3/h10-12,14H,4-9H2,1-3H3 |
| InChIKey | PYRGFGLMUPNQQH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|