C11H21NO5S — CID 99794576
trans-methyl (1R,2S)-2-(2-ethoxyethylsulfamoyl)cyclopentane-1-carboxylate (PubChem CID 99794576) has the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. Its IUPAC name is trans-methyl (1R,2S)-2-(2-ethoxyethylsulfamoyl)cyclopentane-1-carboxylate.
| Compound Name | trans-methyl (1R,2S)-2-(2-ethoxyethylsulfamoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 99794576 |
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | trans-methyl (1R,2S)-2-(2-ethoxyethylsulfamoyl)cyclopentane-1-carboxylate |
| SMILES | CCOCCNS(=O)(=O)[C@H]1CCC[C@@H]1C(=O)OC |
| InChI | InChI=1S/C11H21NO5S/c1-3-17-8-7-12-18(14,15)10-6-4-5-9(10)11(13)16-2/h9-10,12H,3-8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | KUEOCKLEIANCHP-UWVGGRQHSA-N |
| XLogP | 0.28 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|