C12H21NO4S — CID 103343145
methyl 2-(2-cyclopropylethylsulfamoyl)cyclopentane-1-carboxylate (PubChem CID 103343145) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is methyl 2-(2-cyclopropylethylsulfamoyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 2-(2-cyclopropylethylsulfamoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103343145 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | methyl 2-(2-cyclopropylethylsulfamoyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCCC1S(=O)(=O)NCCC1CC1 |
| InChI | InChI=1S/C12H21NO4S/c1-17-12(14)10-3-2-4-11(10)18(15,16)13-8-7-9-5-6-9/h9-11,13H,2-8H2,1H3 |
| InChIKey | RHVVICMCQSKLSV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |