C13H25NO6S — CID 103343206
methyl 2-(2,2-diethoxyethylsulfamoyl)cyclopentane-1-carboxylate (PubChem CID 103343206) has the molecular formula C13H25NO6S and a molecular weight of 323.41 g/mol. Its IUPAC name is methyl 2-(2,2-diethoxyethylsulfamoyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 2-(2,2-diethoxyethylsulfamoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103343206 |
| Molecular Formula | C13H25NO6S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | methyl 2-(2,2-diethoxyethylsulfamoyl)cyclopentane-1-carboxylate |
| SMILES | CCOC(CNS(=O)(=O)C1CCCC1C(=O)OC)OCC |
| InChI | InChI=1S/C13H25NO6S/c1-4-19-12(20-5-2)9-14-21(16,17)11-8-6-7-10(11)13(15)18-3/h10-12,14H,4-9H2,1-3H3 |
| InChIKey | UMLNYXDQYKORST-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|