C12H20N2O4S — CID 75455830
methyl 2-(2-cyanopropylsulfamoyl)cyclohexane-1-carboxylate (PubChem CID 75455830) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is methyl 2-(2-cyanopropylsulfamoyl)cyclohexane-1-carboxylate.
| Compound Name | methyl 2-(2-cyanopropylsulfamoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 75455830 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | methyl 2-(2-cyanopropylsulfamoyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1S(=O)(=O)NCC(C)C#N |
| InChI | InChI=1S/C12H20N2O4S/c1-9(7-13)8-14-19(16,17)11-6-4-3-5-10(11)12(15)18-2/h9-11,14H,3-6,8H2,1-2H3 |
| InChIKey | IZQZXOPPYMYOPD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |