C15H27NO6S — CID 120660593
2-[[(2-methoxycarbonylcyclohexyl)sulfonylamino]methyl]-4-methylpentanoic acid (PubChem CID 120660593) has the molecular formula C15H27NO6S and a molecular weight of 349.45 g/mol. Its IUPAC name is 2-[[(2-methoxycarbonylcyclohexyl)sulfonylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(2-methoxycarbonylcyclohexyl)sulfonylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120660593 |
| Molecular Formula | C15H27NO6S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-[[(2-methoxycarbonylcyclohexyl)sulfonylamino]methyl]-4-methylpentanoic acid |
| SMILES | COC(=O)C1CCCCC1S(=O)(=O)NCC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C15H27NO6S/c1-10(2)8-11(14(17)18)9-16-23(20,21)13-7-5-4-6-12(13)15(19)22-3/h10-13,16H,4-9H2,1-3H3,(H,17,18) |
| InChIKey | YVTOTPLXZSBPBG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |