C10H16O7S — CID 134222553
2,3-bis(methoxycarbonyl)cyclohexane-1-sulfonic acid (PubChem CID 134222553) has the molecular formula C10H16O7S and a molecular weight of 280.30 g/mol. Its IUPAC name is 2,3-bis(methoxycarbonyl)cyclohexane-1-sulfonic acid.
| Compound Name | 2,3-bis(methoxycarbonyl)cyclohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 134222553 |
| Molecular Formula | C10H16O7S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2,3-bis(methoxycarbonyl)cyclohexane-1-sulfonic acid |
| SMILES | COC(=O)C1CCCC(S(=O)(=O)O)C1C(=O)OC |
| InChI | InChI=1S/C10H16O7S/c1-16-9(11)6-4-3-5-7(18(13,14)15)8(6)10(12)17-2/h6-8H,3-5H2,1-2H3,(H,13,14,15) |
| InChIKey | UEWGRPZNFBOBPA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|