C14H25NO5S — CID 103343368
methyl 2-[(2-hydroxycycloheptyl)sulfamoyl]cyclopentane-1-carboxylate (PubChem CID 103343368) has the molecular formula C14H25NO5S and a molecular weight of 319.42 g/mol. Its IUPAC name is methyl 2-[(2-hydroxycycloheptyl)sulfamoyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 2-[(2-hydroxycycloheptyl)sulfamoyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103343368 |
| Molecular Formula | C14H25NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | methyl 2-[(2-hydroxycycloheptyl)sulfamoyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCCC1S(=O)(=O)NC1CCCCCC1O |
| InChI | InChI=1S/C14H25NO5S/c1-20-14(17)10-6-5-9-13(10)21(18,19)15-11-7-3-2-4-8-12(11)16/h10-13,15-16H,2-9H2,1H3 |
| InChIKey | CZTFIKTWEKQCMQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |