C14H24N2O4S — CID 103342193
methyl 2-(1-azabicyclo[2.2.2]octan-3-ylsulfamoyl)cyclopentane-1-carboxylate (PubChem CID 103342193) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is methyl 2-(1-azabicyclo[2.2.2]octan-3-ylsulfamoyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 2-(1-azabicyclo[2.2.2]octan-3-ylsulfamoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103342193 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | methyl 2-(1-azabicyclo[2.2.2]octan-3-ylsulfamoyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCCC1S(=O)(=O)NC1CN2CCC1CC2 |
| InChI | InChI=1S/C14H24N2O4S/c1-20-14(17)11-3-2-4-13(11)21(18,19)15-12-9-16-7-5-10(12)6-8-16/h10-13,15H,2-9H2,1H3 |
| InChIKey | ZJYBQCUBJHFFQN-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |