C12H22N2O4S — CID 120874816
methyl 2-(3-aminopyrrolidin-1-yl)sulfonylcyclohexane-1-carboxylate (PubChem CID 120874816) has the molecular formula C12H22N2O4S and a molecular weight of 290.39 g/mol. Its IUPAC name is methyl 2-(3-aminopyrrolidin-1-yl)sulfonylcyclohexane-1-carboxylate.
| Compound Name | methyl 2-(3-aminopyrrolidin-1-yl)sulfonylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 120874816 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl 2-(3-aminopyrrolidin-1-yl)sulfonylcyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1S(=O)(=O)N1CCC(N)C1 |
| InChI | InChI=1S/C12H22N2O4S/c1-18-12(15)10-4-2-3-5-11(10)19(16,17)14-7-6-9(13)8-14/h9-11H,2-8,13H2,1H3 |
| InChIKey | OBNBCKILYNZOAH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |