C13H20F3NO5S — CID 136532512
methyl 2-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]sulfonylcyclohexane-1-carboxylate (PubChem CID 136532512) has the molecular formula C13H20F3NO5S and a molecular weight of 359.37 g/mol. Its IUPAC name is methyl 2-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]sulfonylcyclohexane-1-carboxylate.
| Compound Name | methyl 2-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]sulfonylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 136532512 |
| Molecular Formula | C13H20F3NO5S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | methyl 2-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]sulfonylcyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1S(=O)(=O)N1CCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H20F3NO5S/c1-22-11(18)9-4-2-3-5-10(9)23(20,21)17-7-6-12(19,8-17)13(14,15)16/h9-10,19H,2-8H2,1H3 |
| InChIKey | FZDVRGPCFDXBGR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |