C13H20N2O5S — CID 103343577
2-[(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)sulfonyl]cyclopentane-1-carboxylic acid (PubChem CID 103343577) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-[(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)sulfonyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)sulfonyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103343577 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)sulfonyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C1NCC2C1CCCN2S(=O)(=O)C1CCCC1C(=O)O |
| InChI | InChI=1S/C13H20N2O5S/c16-12-8-4-2-6-15(10(8)7-14-12)21(19,20)11-5-1-3-9(11)13(17)18/h8-11H,1-7H2,(H,14,16)(H,17,18) |
| InChIKey | KMALTBCCJIHOAL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |