C10H14N2O2S2 — CID 103344629
2-(5,6-dimethyl-1,4-dithian-2-yl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 103344629) has the molecular formula C10H14N2O2S2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1,4-dithian-2-yl)-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-(5,6-dimethyl-1,4-dithian-2-yl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103344629 |
| Molecular Formula | C10H14N2O2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-(5,6-dimethyl-1,4-dithian-2-yl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | CC1SCC(c2nc(O)cc(=O)[nH]2)SC1C |
| InChI | InChI=1S/C10H14N2O2S2/c1-5-6(2)16-7(4-15-5)10-11-8(13)3-9(14)12-10/h3,5-7H,4H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | SXJISZNIVDRKJU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |