C14H23N3S2 — CID 103346600
2-(5,6-dimethyl-1,4-dithian-2-yl)-N,6-diethylpyrimidin-4-amine (PubChem CID 103346600) has the molecular formula C14H23N3S2 and a molecular weight of 297.49 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1,4-dithian-2-yl)-N,6-diethylpyrimidin-4-amine.
| Compound Name | 2-(5,6-dimethyl-1,4-dithian-2-yl)-N,6-diethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 103346600 |
| Molecular Formula | C14H23N3S2 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-(5,6-dimethyl-1,4-dithian-2-yl)-N,6-diethylpyrimidin-4-amine |
| SMILES | CCNc1cc(CC)nc(C2CSC(C)C(C)S2)n1 |
| InChI | InChI=1S/C14H23N3S2/c1-5-11-7-13(15-6-2)17-14(16-11)12-8-18-9(3)10(4)19-12/h7,9-10,12H,5-6,8H2,1-4H3,(H,15,16,17) |
| InChIKey | QSTHVOWPCNNFFS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |