C13H21N3S2 — CID 79966267
2-(1,4-dithian-2-yl)-6-ethyl-N-propylpyrimidin-4-amine (PubChem CID 79966267) has the molecular formula C13H21N3S2 and a molecular weight of 283.47 g/mol. Its IUPAC name is 2-(1,4-dithian-2-yl)-6-ethyl-N-propylpyrimidin-4-amine.
| Compound Name | 2-(1,4-dithian-2-yl)-6-ethyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79966267 |
| Molecular Formula | C13H21N3S2 |
| Molecular Weight | 283.47 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-(1,4-dithian-2-yl)-6-ethyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1cc(CC)nc(C2CSCCS2)n1 |
| InChI | InChI=1S/C13H21N3S2/c1-3-5-14-12-8-10(4-2)15-13(16-12)11-9-17-6-7-18-11/h8,11H,3-7,9H2,1-2H3,(H,14,15,16) |
| InChIKey | WZMRZXLVVLPCKC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |