C11H15ClN2S2 — CID 79972992
4-chloro-2-(1,4-dithian-2-yl)-6-propylpyrimidine (PubChem CID 79972992) has the molecular formula C11H15ClN2S2 and a molecular weight of 274.84 g/mol. Its IUPAC name is 4-chloro-2-(1,4-dithian-2-yl)-6-propylpyrimidine.
| Compound Name | 4-chloro-2-(1,4-dithian-2-yl)-6-propylpyrimidine |
|---|---|
| PubChem CID | 79972992 |
| Molecular Formula | C11H15ClN2S2 |
| Molecular Weight | 274.84 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 4-chloro-2-(1,4-dithian-2-yl)-6-propylpyrimidine |
| SMILES | CCCc1cc(Cl)nc(C2CSCCS2)n1 |
| InChI | InChI=1S/C11H15ClN2S2/c1-2-3-8-6-10(12)14-11(13-8)9-7-15-4-5-16-9/h6,9H,2-5,7H2,1H3 |
| InChIKey | NFIGPTCIWJPDIU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.84 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |