C12H16N4S3 — CID 79965315
[2-(1,4-dithian-2-yl)-6-ethylthieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 79965315) has the molecular formula C12H16N4S3 and a molecular weight of 312.49 g/mol. Its IUPAC name is [2-(1,4-dithian-2-yl)-6-ethylthieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(1,4-dithian-2-yl)-6-ethylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 79965315 |
| Molecular Formula | C12H16N4S3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | [2-(1,4-dithian-2-yl)-6-ethylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | CCc1cc2c(NN)nc(C3CSCCS3)nc2s1 |
| InChI | InChI=1S/C12H16N4S3/c1-2-7-5-8-10(16-13)14-11(15-12(8)19-7)9-6-17-3-4-18-9/h5,9H,2-4,6,13H2,1H3,(H,14,15,16) |
| InChIKey | PNUBZSLZNDQKBG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|