C12H15N3S3 — CID 79966652
2-(1,4-dithian-2-yl)-N-ethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 79966652) has the molecular formula C12H15N3S3 and a molecular weight of 297.47 g/mol. Its IUPAC name is 2-(1,4-dithian-2-yl)-N-ethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(1,4-dithian-2-yl)-N-ethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 79966652 |
| Molecular Formula | C12H15N3S3 |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-(1,4-dithian-2-yl)-N-ethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCNc1nc(C2CSCCS2)nc2sccc12 |
| InChI | InChI=1S/C12H15N3S3/c1-2-13-10-8-3-4-18-12(8)15-11(14-10)9-7-16-5-6-17-9/h3-4,9H,2,5-7H2,1H3,(H,13,14,15) |
| InChIKey | LUDCJUUDMODMHH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |