C11H13N3OS2 — CID 79968552
N-methyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 79968552) has the molecular formula C11H13N3OS2 and a molecular weight of 267.38 g/mol. Its IUPAC name is N-methyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-methyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 79968552 |
| Molecular Formula | C11H13N3OS2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | N-methyl-2-(1,4-oxathian-2-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CNc1nc(C2CSCCO2)nc2sccc12 |
| InChI | InChI=1S/C11H13N3OS2/c1-12-9-7-2-4-17-11(7)14-10(13-9)8-6-16-5-3-15-8/h2,4,8H,3,5-6H2,1H3,(H,12,13,14) |
| InChIKey | RFBOKAADBSVFJF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |