About [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine
[5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine (PubChem CID 79969957) has the molecular formula C10H16N4OS
and a molecular weight of 240.33 g/mol. Its IUPAC name is [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine |
| PubChem CID | 79969957 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(C2CSCCO2)nc(NN)c1C |
| InChI | InChI=1S/C10H16N4OS/c1-6-7(2)12-10(13-9(6)14-11)8-5-16-4-3-15-8/h8H,3-5,11H2,1-2H3,(H,12,13,14) |
| InChIKey | AYISEEMAFJFZKE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine?
The IUPAC name of [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine (CID 79969957) is [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine?
The canonical SMILES for [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine is Cc1nc(C2CSCCO2)nc(NN)c1C.
What is the InChIKey of [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine?
The InChIKey is AYISEEMAFJFZKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4OS/c1-6-7(2)12-10(13-9(6)14-11)8-5-16-4-3-15-8/h8H,3-5,11H2,1-2H3,(H,12,13,14).
What are the key properties of [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine?
[5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine has a molecular weight of 240.33 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 79969957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).