C10H16N4OS — CID 79969957
[5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine (PubChem CID 79969957) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 79969957 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [5,6-dimethyl-2-(1,4-oxathian-2-yl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(C2CSCCO2)nc(NN)c1C |
| InChI | InChI=1S/C10H16N4OS/c1-6-7(2)12-10(13-9(6)14-11)8-5-16-4-3-15-8/h8H,3-5,11H2,1-2H3,(H,12,13,14) |
| InChIKey | AYISEEMAFJFZKE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|