C12H18IN3OS — CID 79968440
5-iodo-N-methyl-2-(1,4-oxathian-2-yl)-6-propan-2-ylpyrimidin-4-amine (PubChem CID 79968440) has the molecular formula C12H18IN3OS and a molecular weight of 379.27 g/mol. Its IUPAC name is 5-iodo-N-methyl-2-(1,4-oxathian-2-yl)-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | 5-iodo-N-methyl-2-(1,4-oxathian-2-yl)-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79968440 |
| Molecular Formula | C12H18IN3OS |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 5-iodo-N-methyl-2-(1,4-oxathian-2-yl)-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CNc1nc(C2CSCCO2)nc(C(C)C)c1I |
| InChI | InChI=1S/C12H18IN3OS/c1-7(2)10-9(13)12(14-3)16-11(15-10)8-6-18-5-4-17-8/h7-8H,4-6H2,1-3H3,(H,14,15,16) |
| InChIKey | ZPFOHXHLXHLTFI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|