C9H13N3OS — CID 79968812
N-methyl-2-(1,4-oxathian-2-yl)pyrimidin-4-amine (PubChem CID 79968812) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is N-methyl-2-(1,4-oxathian-2-yl)pyrimidin-4-amine.
| Compound Name | N-methyl-2-(1,4-oxathian-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 79968812 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-methyl-2-(1,4-oxathian-2-yl)pyrimidin-4-amine |
| SMILES | CNc1ccnc(C2CSCCO2)n1 |
| InChI | InChI=1S/C9H13N3OS/c1-10-8-2-3-11-9(12-8)7-6-14-5-4-13-7/h2-3,7H,4-6H2,1H3,(H,10,11,12) |
| InChIKey | LZFQFUVQWWEJOI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |