C6H9N3O2S — CID 79962782
3-(1,4-oxathian-2-yl)-1,2,4-oxadiazol-5-amine (PubChem CID 79962782) has the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. Its IUPAC name is 3-(1,4-oxathian-2-yl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(1,4-oxathian-2-yl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 79962782 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 3-(1,4-oxathian-2-yl)-1,2,4-oxadiazol-5-amine |
| SMILES | Nc1nc(C2CSCCO2)no1 |
| InChI | InChI=1S/C6H9N3O2S/c7-6-8-5(9-11-6)4-3-12-2-1-10-4/h4H,1-3H2,(H2,7,8,9) |
| InChIKey | MDDWIWDMPLNQKN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |