C15H19N3O2S — CID 80549567
4-[2-[3-(1,4-oxathian-2-yl)-1,2,4-oxadiazol-5-yl]propan-2-yl]aniline (PubChem CID 80549567) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-[2-[3-(1,4-oxathian-2-yl)-1,2,4-oxadiazol-5-yl]propan-2-yl]aniline.
| Compound Name | 4-[2-[3-(1,4-oxathian-2-yl)-1,2,4-oxadiazol-5-yl]propan-2-yl]aniline |
|---|---|
| PubChem CID | 80549567 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-[2-[3-(1,4-oxathian-2-yl)-1,2,4-oxadiazol-5-yl]propan-2-yl]aniline |
| SMILES | CC(C)(c1ccc(N)cc1)c1nc(C2CSCCO2)no1 |
| InChI | InChI=1S/C15H19N3O2S/c1-15(2,10-3-5-11(16)6-4-10)14-17-13(18-20-14)12-9-21-8-7-19-12/h3-6,12H,7-9,16H2,1-2H3 |
| InChIKey | UDSCDAUHACEUIM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|