C16H21N3O2 — CID 80549479
4-[2-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]propan-2-yl]aniline (PubChem CID 80549479) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[2-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]propan-2-yl]aniline.
| Compound Name | 4-[2-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]propan-2-yl]aniline |
|---|---|
| PubChem CID | 80549479 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-[2-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]propan-2-yl]aniline |
| SMILES | CC(C)(c1ccc(N)cc1)c1nc(C2CCCOC2)no1 |
| InChI | InChI=1S/C16H21N3O2/c1-16(2,12-5-7-13(17)8-6-12)15-18-14(19-21-15)11-4-3-9-20-10-11/h5-8,11H,3-4,9-10,17H2,1-2H3 |
| InChIKey | VZTYIEXBWQMZOW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|