C16H27N3S2 — CID 103346829
3-[2-(5,6-dimethyl-1,4-dithian-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-methylpropan-1-amine (PubChem CID 103346829) has the molecular formula C16H27N3S2 and a molecular weight of 325.55 g/mol. Its IUPAC name is 3-[2-(5,6-dimethyl-1,4-dithian-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[2-(5,6-dimethyl-1,4-dithian-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 103346829 |
| Molecular Formula | C16H27N3S2 |
| Molecular Weight | 325.55 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 3-[2-(5,6-dimethyl-1,4-dithian-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCc1c(C)nc(C2CSC(C)C(C)S2)nc1C |
| InChI | InChI=1S/C16H27N3S2/c1-10-14(7-6-8-17-5)11(2)19-16(18-10)15-9-20-12(3)13(4)21-15/h12-13,15,17H,6-9H2,1-5H3 |
| InChIKey | REKMIDRSIRXECF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|