C14H20IN3S2 — CID 103346677
6-cyclopropyl-2-(5,6-dimethyl-1,4-dithian-2-yl)-5-iodo-N-methylpyrimidin-4-amine (PubChem CID 103346677) has the molecular formula C14H20IN3S2 and a molecular weight of 421.37 g/mol. Its IUPAC name is 6-cyclopropyl-2-(5,6-dimethyl-1,4-dithian-2-yl)-5-iodo-N-methylpyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-2-(5,6-dimethyl-1,4-dithian-2-yl)-5-iodo-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 103346677 |
| Molecular Formula | C14H20IN3S2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 6-cyclopropyl-2-(5,6-dimethyl-1,4-dithian-2-yl)-5-iodo-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(C2CSC(C)C(C)S2)nc(C2CC2)c1I |
| InChI | InChI=1S/C14H20IN3S2/c1-7-8(2)20-10(6-19-7)13-17-12(9-4-5-9)11(15)14(16-3)18-13/h7-10H,4-6H2,1-3H3,(H,16,17,18) |
| InChIKey | BCCFOBUTYZJWKW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|