C13H18IN3S2 — CID 115388664
6-cyclopropyl-5-iodo-N-methyl-2-(3-methyl-1,4-dithian-2-yl)pyrimidin-4-amine (PubChem CID 115388664) has the molecular formula C13H18IN3S2 and a molecular weight of 407.35 g/mol. Its IUPAC name is 6-cyclopropyl-5-iodo-N-methyl-2-(3-methyl-1,4-dithian-2-yl)pyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-5-iodo-N-methyl-2-(3-methyl-1,4-dithian-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115388664 |
| Molecular Formula | C13H18IN3S2 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | 6-cyclopropyl-5-iodo-N-methyl-2-(3-methyl-1,4-dithian-2-yl)pyrimidin-4-amine |
| SMILES | CNc1nc(C2SCCSC2C)nc(C2CC2)c1I |
| InChI | InChI=1S/C13H18IN3S2/c1-7-11(19-6-5-18-7)13-16-10(8-3-4-8)9(14)12(15-2)17-13/h7-8,11H,3-6H2,1-2H3,(H,15,16,17) |
| InChIKey | UIYRGFOHPPTCGW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|