C12H18IN3O — CID 79196796
6-cyclopropyl-5-iodo-2-(2-methoxypropan-2-yl)-N-methylpyrimidin-4-amine (PubChem CID 79196796) has the molecular formula C12H18IN3O and a molecular weight of 347.20 g/mol. Its IUPAC name is 6-cyclopropyl-5-iodo-2-(2-methoxypropan-2-yl)-N-methylpyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-5-iodo-2-(2-methoxypropan-2-yl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79196796 |
| Molecular Formula | C12H18IN3O |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 6-cyclopropyl-5-iodo-2-(2-methoxypropan-2-yl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(C(C)(C)OC)nc(C2CC2)c1I |
| InChI | InChI=1S/C12H18IN3O/c1-12(2,17-4)11-15-9(7-5-6-7)8(13)10(14-3)16-11/h7H,5-6H2,1-4H3,(H,14,15,16) |
| InChIKey | FWPLMUWWHVJJMH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|