C13H18IN3 — CID 107925746
6-cyclopropyl-2-(2,2-dimethylcyclopropyl)-5-iodo-N-methylpyrimidin-4-amine (PubChem CID 107925746) has the molecular formula C13H18IN3 and a molecular weight of 343.21 g/mol. Its IUPAC name is 6-cyclopropyl-2-(2,2-dimethylcyclopropyl)-5-iodo-N-methylpyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-2-(2,2-dimethylcyclopropyl)-5-iodo-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107925746 |
| Molecular Formula | C13H18IN3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 6-cyclopropyl-2-(2,2-dimethylcyclopropyl)-5-iodo-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(C2CC2(C)C)nc(C2CC2)c1I |
| InChI | InChI=1S/C13H18IN3/c1-13(2)6-8(13)11-16-10(7-4-5-7)9(14)12(15-3)17-11/h7-8H,4-6H2,1-3H3,(H,15,16,17) |
| InChIKey | OZHITXUABDQQTJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|